C23H29N5O2 — CID 118459390
N-[2-[3-ethyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]iminohydrazinyl]-N-methylformamide (PubChem CID 118459390) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[2-[3-ethyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]iminohydrazinyl]-N-methylformamide.
| Compound Name | N-[2-[3-ethyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]iminohydrazinyl]-N-methylformamide |
|---|---|
| PubChem CID | 118459390 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[2-[3-ethyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]iminohydrazinyl]-N-methylformamide |
| SMILES | CCc1cccc(/N=N/NN(C)C=O)c1CON=C(C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H29N5O2/c1-4-18-10-7-11-23(24-26-27-28(3)16-29)22(18)15-30-25-17(2)20-13-12-19-8-5-6-9-21(19)14-20/h7,10-14,16H,4-6,8-9,15H2,1-3H3,(H,24,27) |
| InChIKey | HPBLMZMIMKJNHR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|