About 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one
2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one (PubChem CID 118460130) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one |
| PubChem CID | 118460130 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one |
| SMILES | CC(C)(C)N1Cc2cc(O)c(O)cc2C1=O |
| InChI | InChI=1S/C12H15NO3/c1-12(2,3)13-6-7-4-9(14)10(15)5-8(7)11(13)16/h4-5,14-15H,6H2,1-3H3 |
| InChIKey | XILQDQOVJYCLFF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one?
The IUPAC name of 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one (CID 118460130) is 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one.
What is the SMILES notation for 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one?
The canonical SMILES for 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one is CC(C)(C)N1Cc2cc(O)c(O)cc2C1=O.
What is the InChIKey of 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one?
The InChIKey is XILQDQOVJYCLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-12(2,3)13-6-7-4-9(14)10(15)5-8(7)11(13)16/h4-5,14-15H,6H2,1-3H3.
What are the key properties of 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one?
2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one has a molecular weight of 221.26 g/mol, XLogP of 1.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5,6-dihydroxy-3H-isoindol-1-one is sourced from PubChem (CID 118460130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).