C32H37NO2P — CID 11846062
CID 11846062 (PubChem CID 11846062) has the molecular formula C32H37NO2P and a molecular weight of 498.63 g/mol.
| Compound Name | CID 11846062 |
|---|---|
| PubChem CID | 11846062 |
| Molecular Formula | C32H37NO2P |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | — |
| SMILES | COc1c(C)cc(P([C]2[CH][CH][CH][C]2[C@@H](c2ccccc2)N(C)C)c2cc(C)c(OC)c(C)c2)cc1C |
| InChI | InChI=1S/C32H37NO2P/c1-21-17-26(18-22(2)31(21)34-7)36(27-19-23(3)32(35-8)24(4)20-27)29-16-12-15-28(29)30(33(5)6)25-13-10-9-11-14-25/h9-20,30H,1-8H3/t30-/m1/s1 |
| InChIKey | XUWOZTNQYWCXED-SSEXGKCCSA-N |
| XLogP | 6.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|