About CID 11846063
CID 11846063 (PubChem CID 11846063) has the molecular formula C15H19BP
and a molecular weight of 241.10 g/mol.
Molecular Properties
| Compound Name | CID 11846063 |
| PubChem CID | 11846063 |
| Molecular Formula | C15H19BP |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | — |
| SMILES | C=C(C1=CCCCC1)P(C)c1ccccc1.[B] |
| InChI | InChI=1S/C15H19P.B/c1-13(14-9-5-3-6-10-14)16(2)15-11-7-4-8-12-15;/h4,7-9,11-12H,1,3,5-6,10H2,2H3; |
| InChIKey | OFZGBVYEBYAMRO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11846063 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11846063?
The IUPAC name of CID 11846063 (CID 11846063) is not available.
What is the SMILES notation for CID 11846063?
The canonical SMILES for CID 11846063 is C=C(C1=CCCCC1)P(C)c1ccccc1.[B].
What is the InChIKey of CID 11846063?
The InChIKey is OFZGBVYEBYAMRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19P.B/c1-13(14-9-5-3-6-10-14)16(2)15-11-7-4-8-12-15;/h4,7-9,11-12H,1,3,5-6,10H2,2H3;.
What are the key properties of CID 11846063?
CID 11846063 has a molecular weight of 241.10 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11846063 is sourced from PubChem (CID 11846063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).