C23H21N5O5S — CID 1184608
N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 1184608) has the molecular formula C23H21N5O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 1184608 |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(N4C(=O)CCC4=O)cc3)cc2)n1 |
| InChI | InChI=1S/C23H21N5O5S/c1-14-13-15(2)25-23(24-14)27-34(32,33)19-9-5-17(6-10-19)26-22(31)16-3-7-18(8-4-16)28-20(29)11-12-21(28)30/h3-10,13H,11-12H2,1-2H3,(H,26,31)(H,24,25,27) |
| InChIKey | JNDAJVHXDZJEIX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|