About 5,6-dihydroxy-2-methoxyisoindole-1,3-dione
5,6-dihydroxy-2-methoxyisoindole-1,3-dione (PubChem CID 118461175) has the molecular formula C9H7NO5
and a molecular weight of 209.16 g/mol. Its IUPAC name is 5,6-dihydroxy-2-methoxyisoindole-1,3-dione.
Molecular Properties
| Compound Name | 5,6-dihydroxy-2-methoxyisoindole-1,3-dione |
| PubChem CID | 118461175 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 5,6-dihydroxy-2-methoxyisoindole-1,3-dione |
| SMILES | CON1C(=O)c2cc(O)c(O)cc2C1=O |
| InChI | InChI=1S/C9H7NO5/c1-15-10-8(13)4-2-6(11)7(12)3-5(4)9(10)14/h2-3,11-12H,1H3 |
| InChIKey | NNITTZRXYYCYGW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydroxy-2-methoxyisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxy-2-methoxyisoindole-1,3-dione?
The IUPAC name of 5,6-dihydroxy-2-methoxyisoindole-1,3-dione (CID 118461175) is 5,6-dihydroxy-2-methoxyisoindole-1,3-dione.
What is the SMILES notation for 5,6-dihydroxy-2-methoxyisoindole-1,3-dione?
The canonical SMILES for 5,6-dihydroxy-2-methoxyisoindole-1,3-dione is CON1C(=O)c2cc(O)c(O)cc2C1=O.
What is the InChIKey of 5,6-dihydroxy-2-methoxyisoindole-1,3-dione?
The InChIKey is NNITTZRXYYCYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO5/c1-15-10-8(13)4-2-6(11)7(12)3-5(4)9(10)14/h2-3,11-12H,1H3.
What are the key properties of 5,6-dihydroxy-2-methoxyisoindole-1,3-dione?
5,6-dihydroxy-2-methoxyisoindole-1,3-dione has a molecular weight of 209.16 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxy-2-methoxyisoindole-1,3-dione is sourced from PubChem (CID 118461175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).