C21H34N3O5P — CID 118461485
[2-[(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate (PubChem CID 118461485) has the molecular formula C21H34N3O5P and a molecular weight of 439.49 g/mol. Its IUPAC name is [2-[(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate.
| Compound Name | [2-[(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
|---|---|
| PubChem CID | 118461485 |
| Molecular Formula | C21H34N3O5P |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | [2-[(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
| SMILES | CC/N=C/OP(OCCN1C(=O)[C@@H]2[C@H](C1=O)C1(C)C=CC2(C)O1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C21H34N3O5P/c1-8-22-13-28-30(24(14(2)3)15(4)5)27-12-11-23-18(25)16-17(19(23)26)21(7)10-9-20(16,6)29-21/h9-10,13-17H,8,11-12H2,1-7H3/b22-13+/t16-,17+,20?,21?,30? |
| InChIKey | CYICYAMMJZTRRO-SQPBVBAMSA-N |
| XLogP | 3.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|