About 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one
3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one (PubChem CID 11846158) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one |
| PubChem CID | 11846158 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CC[C@H]1NCCC[C@@H]1O |
| InChI | InChI=1S/C15H19N3O2/c19-14-6-3-8-16-13(14)7-9-18-10-17-12-5-2-1-4-11(12)15(18)20/h1-2,4-5,10,13-14,16,19H,3,6-9H2/t13-,14+/m1/s1 |
| InChIKey | PGTWLNXGCUNLSF-KGLIPLIRSA-N |
| XLogP | 0.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one?
The IUPAC name of 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one (CID 11846158) is 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one.
What is the SMILES notation for 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one?
The canonical SMILES for 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one is O=c1c2ccccc2ncn1CC[C@H]1NCCC[C@@H]1O.
What is the InChIKey of 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one?
The InChIKey is PGTWLNXGCUNLSF-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H19N3O2/c19-14-6-3-8-16-13(14)7-9-18-10-17-12-5-2-1-4-11(12)15(18)20/h1-2,4-5,10,13-14,16,19H,3,6-9H2/t13-,14+/m1/s1.
What are the key properties of 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one?
3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one has a molecular weight of 273.34 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2R,3S)-3-hydroxypiperidin-2-yl]ethyl]quinazolin-4-one is sourced from PubChem (CID 11846158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).