About (2,5-dioxopyrrolidin-1-yl) pent-3-enoate
(2,5-dioxopyrrolidin-1-yl) pent-3-enoate (PubChem CID 118461768) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) pent-3-enoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) pent-3-enoate |
| PubChem CID | 118461768 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) pent-3-enoate |
| SMILES | CC=CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H11NO4/c1-2-3-4-9(13)14-10-7(11)5-6-8(10)12/h2-3H,4-6H2,1H3 |
| InChIKey | LCDFGHZPVYJXOM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) pent-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) pent-3-enoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) pent-3-enoate (CID 118461768) is (2,5-dioxopyrrolidin-1-yl) pent-3-enoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) pent-3-enoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) pent-3-enoate is CC=CCC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) pent-3-enoate?
The InChIKey is LCDFGHZPVYJXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-2-3-4-9(13)14-10-7(11)5-6-8(10)12/h2-3H,4-6H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) pent-3-enoate?
(2,5-dioxopyrrolidin-1-yl) pent-3-enoate has a molecular weight of 197.19 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) pent-3-enoate is sourced from PubChem (CID 118461768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).