C13H19NO3S — CID 118463244
4-(4-tert-butylphenyl)-1,3,4-oxathiazinane 3,3-dioxide (PubChem CID 118463244) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-1,3,4-oxathiazinane 3,3-dioxide.
| Compound Name | 4-(4-tert-butylphenyl)-1,3,4-oxathiazinane 3,3-dioxide |
|---|---|
| PubChem CID | 118463244 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-(4-tert-butylphenyl)-1,3,4-oxathiazinane 3,3-dioxide |
| SMILES | CC(C)(C)c1ccc(N2CCOCS2(=O)=O)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-13(2,3)11-4-6-12(7-5-11)14-8-9-17-10-18(14,15)16/h4-7H,8-10H2,1-3H3 |
| InChIKey | BVKVNEBIQGWSOO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |