C12H22O — CID 118463335
2-(ethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 118463335) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-(ethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 2-(ethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 118463335 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-(ethoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCOCC1CC2CCCCC2C1 |
| InChI | InChI=1S/C12H22O/c1-2-13-9-10-7-11-5-3-4-6-12(11)8-10/h10-12H,2-9H2,1H3 |
| InChIKey | YERNONKFHKCVJC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |