C26H28N6O2 — CID 118463873
2-(3-hydroxypiperidin-1-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide (PubChem CID 118463873) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-(3-hydroxypiperidin-1-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide.
| Compound Name | 2-(3-hydroxypiperidin-1-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463873 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-(3-hydroxypiperidin-1-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc2nc(N3CCCC(O)C3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C26H28N6O2/c33-21-8-4-14-32(17-21)25-24(19-6-2-1-3-7-19)29-23-16-20(9-10-22(23)30-25)26(34)28-11-5-13-31-15-12-27-18-31/h1-3,6-7,9-10,12,15-16,18,21,33H,4-5,8,11,13-14,17H2,(H,28,34) |
| InChIKey | FAAVSCKOKKGBJA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|