About [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone
[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone (PubChem CID 118463945) has the molecular formula C30H22F2N4O2
and a molecular weight of 508.53 g/mol. Its IUPAC name is [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone |
| PubChem CID | 118463945 |
| Molecular Formula | C30H22F2N4O2 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone |
| SMILES | O=C(c1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1)N1CCOC(c2cccnc2)C1 |
| InChI | InChI=1S/C30H22F2N4O2/c31-23-8-3-19(4-9-23)28-29(20-5-10-24(32)11-6-20)35-26-16-21(7-12-25(26)34-28)30(37)36-14-15-38-27(18-36)22-2-1-13-33-17-22/h1-13,16-17,27H,14-15,18H2 |
| InChIKey | UOROFHJNOHYOIG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone?
The IUPAC name of [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone (CID 118463945) is [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone.
What is the SMILES notation for [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone?
The canonical SMILES for [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone is O=C(c1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1)N1CCOC(c2cccnc2)C1.
What is the InChIKey of [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone?
The InChIKey is UOROFHJNOHYOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22F2N4O2/c31-23-8-3-19(4-9-23)28-29(20-5-10-24(32)11-6-20)35-26-16-21(7-12-25(26)34-28)30(37)36-14-15-38-27(18-36)22-2-1-13-33-17-22/h1-13,16-17,27H,14-15,18H2.
What are the key properties of [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone?
[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone has a molecular weight of 508.53 g/mol, XLogP of 5.85, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-(2-pyridin-3-ylmorpholin-4-yl)methanone is sourced from PubChem (CID 118463945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).