C14H18IN5 — CID 118464429
4-N-(3-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,4-diene-2,4-diamine (PubChem CID 118464429) has the molecular formula C14H18IN5 and a molecular weight of 383.24 g/mol. Its IUPAC name is 4-N-(3-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,4-diene-2,4-diamine.
| Compound Name | 4-N-(3-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,4-diene-2,4-diamine |
|---|---|
| PubChem CID | 118464429 |
| Molecular Formula | C14H18IN5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-N-(3-iodophenyl)-1,3,5-triazaspiro[5.5]undeca-1,4-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N=C(Nc2cccc(I)c2)N1 |
| InChI | InChI=1S/C14H18IN5/c15-10-5-4-6-11(9-10)17-13-18-12(16)19-14(20-13)7-2-1-3-8-14/h4-6,9H,1-3,7-8H2,(H4,16,17,18,19,20) |
| InChIKey | HMTGYTOCZCEPBI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|