About 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine
2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (PubChem CID 11846465) has the molecular formula C18H17ClFN3O
and a molecular weight of 345.81 g/mol. Its IUPAC name is 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| PubChem CID | 11846465 |
| Molecular Formula | C18H17ClFN3O |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| SMILES | CN1CCN(C2=Nc3ccc(Cl)cc3Oc3cc(F)ccc32)CC1 |
| InChI | InChI=1S/C18H17ClFN3O/c1-22-6-8-23(9-7-22)18-14-4-3-13(20)11-16(14)24-17-10-12(19)2-5-15(17)21-18/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | NBMDNUKKIXJADO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
The IUPAC name of 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (CID 11846465) is 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine.
What is the SMILES notation for 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
The canonical SMILES for 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine is CN1CCN(C2=Nc3ccc(Cl)cc3Oc3cc(F)ccc32)CC1.
What is the InChIKey of 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
The InChIKey is NBMDNUKKIXJADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClFN3O/c1-22-6-8-23(9-7-22)18-14-4-3-13(20)11-16(14)24-17-10-12(19)2-5-15(17)21-18/h2-5,10-11H,6-9H2,1H3.
What are the key properties of 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine has a molecular weight of 345.81 g/mol, XLogP of 3.91, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-9-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine is sourced from PubChem (CID 11846465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).