C69H82F8O2 — CID 118465019
2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluorooctyl)fluorene (PubChem CID 118465019) has the molecular formula C69H82F8O2 and a molecular weight of 1095.40 g/mol. Its IUPAC name is 2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluorooctyl)fluorene.
| Compound Name | 2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluorooctyl)fluorene |
|---|---|
| PubChem CID | 118465019 |
| Molecular Formula | C69H82F8O2 |
| Molecular Weight | 1095.40 g/mol |
| Exact Mass | 1094.62 |
| IUPAC Name | 2,7-bis[4-(4-octoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluorooctyl)fluorene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C(C(F)(F)C(F)(F)CCCCCC)(C(F)(F)C(F)(F)CCCCCC)c3cc(-c5ccc(-c6ccc(OCCCCCCCC)cc6)cc5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C69H82F8O2/c1-5-9-13-17-19-23-47-78-59-39-33-53(34-40-59)51-25-29-55(30-26-51)57-37-43-61-62-44-38-58(56-31-27-52(28-32-56)54-35-41-60(42-36-54)79-48-24-20-18-14-10-6-2)50-64(62)67(63(61)49-57,68(74,75)65(70,71)45-21-15-11-7-3)69(76,77)66(72,73)46-22-16-12-8-4/h25-44,49-50H,5-24,45-48H2,1-4H3 |
| InChIKey | HSIFRLIKFJJESP-UHFFFAOYSA-N |
| XLogP | 22.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.40 |
| LogP ≤ 5 | 22.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|