C34H32N3O6P3 — CID 118465505
6-hydroxy-3-methyl-1,4,4,6,9-pentaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene (PubChem CID 118465505) has the molecular formula C34H32N3O6P3 and a molecular weight of 671.57 g/mol. Its IUPAC name is 6-hydroxy-3-methyl-1,4,4,6,9-pentaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene.
| Compound Name | 6-hydroxy-3-methyl-1,4,4,6,9-pentaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene |
|---|---|
| PubChem CID | 118465505 |
| Molecular Formula | C34H32N3O6P3 |
| Molecular Weight | 671.57 g/mol |
| Exact Mass | 671.15 |
| IUPAC Name | 6-hydroxy-3-methyl-1,4,4,6,9-pentaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene |
| SMILES | CC1N=P2(Oc3ccccc3)C(N=P(O)(Oc3ccccc3)N=P1(Oc1ccccc1)Oc1ccccc1)C2Oc1ccccc1 |
| InChI | InChI=1S/C34H32N3O6P3/c1-27-35-44(40-29-19-9-3-10-20-29)33(34(44)39-28-17-7-2-8-18-28)36-46(38,43-32-25-15-6-16-26-32)37-45(27,41-30-21-11-4-12-22-30)42-31-23-13-5-14-24-31/h2-27,33-34,38H,1H3 |
| InChIKey | RBDBOPXSPKIOIA-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.57 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|