About 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one
4-methoxy-2-propanoyl-2,3-dihydropyran-6-one (PubChem CID 11846578) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one |
| PubChem CID | 11846578 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one |
| SMILES | CCC(=O)C1CC(OC)=CC(=O)O1 |
| InChI | InChI=1S/C9H12O4/c1-3-7(10)8-4-6(12-2)5-9(11)13-8/h5,8H,3-4H2,1-2H3 |
| InChIKey | HUAFMJFCVIBUGB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one?
The IUPAC name of 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one (CID 11846578) is 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one?
The canonical SMILES for 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one is CCC(=O)C1CC(OC)=CC(=O)O1.
What is the InChIKey of 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one?
The InChIKey is HUAFMJFCVIBUGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-3-7(10)8-4-6(12-2)5-9(11)13-8/h5,8H,3-4H2,1-2H3.
What are the key properties of 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one?
4-methoxy-2-propanoyl-2,3-dihydropyran-6-one has a molecular weight of 184.19 g/mol, XLogP of 0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-propanoyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 11846578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).