C21H40O4Si — CID 11846596
(4R,6R)-4-hydroxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one (PubChem CID 11846596) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is (4R,6R)-4-hydroxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one.
| Compound Name | (4R,6R)-4-hydroxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 11846596 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (4R,6R)-4-hydroxy-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]oxan-2-one |
| SMILES | CC[C@H](/C=C(/C)[C@H]1C[C@@H](O)CC(=O)O1)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-9-18(10-17(8)20-11-19(22)12-21(23)25-20)13-24-26(14(2)3,15(4)5)16(6)7/h10,14-16,18-20,22H,9,11-13H2,1-8H3/b17-10-/t18-,19-,20-/m1/s1 |
| InChIKey | JFZFKAZHVIQXMO-JNWCFWDOSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|