C5H7F2N3 — CID 118466363
1-(2,2-difluoroethyl)-3-methyl-1,2,4-triazole (PubChem CID 118466363) has the molecular formula C5H7F2N3 and a molecular weight of 147.13 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methyl-1,2,4-triazole.
| Compound Name | 1-(2,2-difluoroethyl)-3-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 118466363 |
| Molecular Formula | C5H7F2N3 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-methyl-1,2,4-triazole |
| SMILES | Cc1ncn(CC(F)F)n1 |
| InChI | InChI=1S/C5H7F2N3/c1-4-8-3-10(9-4)2-5(6)7/h3,5H,2H2,1H3 |
| InChIKey | YFBPPGRVYYASHL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |