About 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile
7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile (PubChem CID 118466782) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile.
Molecular Properties
| Compound Name | 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile |
| PubChem CID | 118466782 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile |
| SMILES | N#CC1(O)CCC2(C=C=C2)CC1 |
| InChI | InChI=1S/C10H11NO/c11-8-10(12)6-4-9(5-7-10)2-1-3-9/h2-3,12H,4-7H2 |
| InChIKey | YPDOCFKGEMZSOR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile?
The IUPAC name of 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile (CID 118466782) is 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile.
What is the SMILES notation for 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile?
The canonical SMILES for 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile is N#CC1(O)CCC2(C=C=C2)CC1.
What is the InChIKey of 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile?
The InChIKey is YPDOCFKGEMZSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c11-8-10(12)6-4-9(5-7-10)2-1-3-9/h2-3,12H,4-7H2.
What are the key properties of 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile?
7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile has a molecular weight of 161.20 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxyspiro[3.5]nona-1,2-diene-7-carbonitrile is sourced from PubChem (CID 118466782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).