C12H19N3O3 — CID 118466935
4-nitro-1-(2,2,6,6-tetramethyloxan-4-yl)pyrazole (PubChem CID 118466935) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-nitro-1-(2,2,6,6-tetramethyloxan-4-yl)pyrazole.
| Compound Name | 4-nitro-1-(2,2,6,6-tetramethyloxan-4-yl)pyrazole |
|---|---|
| PubChem CID | 118466935 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-nitro-1-(2,2,6,6-tetramethyloxan-4-yl)pyrazole |
| SMILES | CC1(C)CC(n2cc([N+](=O)[O-])cn2)CC(C)(C)O1 |
| InChI | InChI=1S/C12H19N3O3/c1-11(2)5-9(6-12(3,4)18-11)14-8-10(7-13-14)15(16)17/h7-9H,5-6H2,1-4H3 |
| InChIKey | KHVMMODFZINASE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|