C22H25Cl2N3O4S — CID 118467043
(2E,4E)-5-[4-[[4-[bis(2-chloroethyl)amino]phenyl]sulfonylamino]phenyl]-N-hydroxy-4-methylpenta-2,4-dienamide (PubChem CID 118467043) has the molecular formula C22H25Cl2N3O4S and a molecular weight of 498.43 g/mol. Its IUPAC name is (2E,4E)-5-[4-[[4-[bis(2-chloroethyl)amino]phenyl]sulfonylamino]phenyl]-N-hydroxy-4-methylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-5-[4-[[4-[bis(2-chloroethyl)amino]phenyl]sulfonylamino]phenyl]-N-hydroxy-4-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 118467043 |
| Molecular Formula | C22H25Cl2N3O4S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | (2E,4E)-5-[4-[[4-[bis(2-chloroethyl)amino]phenyl]sulfonylamino]phenyl]-N-hydroxy-4-methylpenta-2,4-dienamide |
| SMILES | CC(/C=C/C(=O)NO)=C\c1ccc(NS(=O)(=O)c2ccc(N(CCCl)CCCl)cc2)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O4S/c1-17(2-11-22(28)25-29)16-18-3-5-19(6-4-18)26-32(30,31)21-9-7-20(8-10-21)27(14-12-23)15-13-24/h2-11,16,26,29H,12-15H2,1H3,(H,25,28)/b11-2+,17-16+ |
| InChIKey | HOWUKPILSTXCSC-MASZBAQNSA-N |
| XLogP | 4.24 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|