About 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione
4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione (PubChem CID 118467449) has the molecular formula C15H25N7O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione |
| PubChem CID | 118467449 |
| Molecular Formula | C15H25N7O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione |
| SMILES | CCC(CC1=NC2(N)C(=N1)C(=O)N(C)C(=O)N2C)N1CCNCC1 |
| InChI | InChI=1S/C15H25N7O2/c1-4-10(22-7-5-17-6-8-22)9-11-18-12-13(23)20(2)14(24)21(3)15(12,16)19-11/h10,17H,4-9,16H2,1-3H3 |
| InChIKey | CUOYKQMCSBUSOE-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione?
The IUPAC name of 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione (CID 118467449) is 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione.
What is the SMILES notation for 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione?
The canonical SMILES for 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione is CCC(CC1=NC2(N)C(=N1)C(=O)N(C)C(=O)N2C)N1CCNCC1.
What is the InChIKey of 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione?
The InChIKey is CUOYKQMCSBUSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N7O2/c1-4-10(22-7-5-17-6-8-22)9-11-18-12-13(23)20(2)14(24)21(3)15(12,16)19-11/h10,17H,4-9,16H2,1-3H3.
What are the key properties of 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione?
4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione has a molecular weight of 335.41 g/mol, XLogP of -0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-dimethyl-8-(2-piperazin-1-ylbutyl)purine-2,6-dione is sourced from PubChem (CID 118467449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).