C26H44O4Si — CID 11846764
(1R,2R,4R,4aS,4bS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthrene-1-carboxylic acid (PubChem CID 11846764) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (1R,2R,4R,4aS,4bS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,2R,4R,4aS,4bS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 11846764 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (1R,2R,4R,4aS,4bS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,5,6,9,10,10a-decahydrophenanthrene-1-carboxylic acid |
| SMILES | CCC(O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@@H](C)[C@@](C)(C(=O)O)[C@H]2CCC3=CC(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H44O4Si/c1-9-22(30-31(7,8)25(3,4)5)20-14-16(2)26(6,24(28)29)21-13-10-17-15-18(27)11-12-19(17)23(20)21/h15-16,19-23H,9-14H2,1-8H3,(H,28,29)/t16-,19-,20+,21+,22?,23-,26-/m1/s1 |
| InChIKey | OKYQZQWZRBWUPD-LTHBIUNWSA-N |
| XLogP | 6.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|