C24H34O6 — CID 11846766
dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-1,2,8-trimethyl-7-oxo-4-propanoyl-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate (PubChem CID 11846766) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-1,2,8-trimethyl-7-oxo-4-propanoyl-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate.
| Compound Name | dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-1,2,8-trimethyl-7-oxo-4-propanoyl-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 11846766 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-1,2,8-trimethyl-7-oxo-4-propanoyl-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate |
| SMILES | CCC(=O)[C@@H]1C[C@@H](C)[C@@](C)(C(=O)OC)[C@H]2CC[C@H]3[C@@H](C=CC(=O)[C@]3(C)C(=O)OC)[C@H]12 |
| InChI | InChI=1S/C24H34O6/c1-7-18(25)15-12-13(2)23(3,21(27)29-5)17-10-9-16-14(20(15)17)8-11-19(26)24(16,4)22(28)30-6/h8,11,13-17,20H,7,9-10,12H2,1-6H3/t13-,14-,15+,16+,17+,20-,23-,24-/m1/s1 |
| InChIKey | IISHBJUOLQVESY-IWUJDIGSSA-N |
| XLogP | 3.38 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|