C24H23N3OS — CID 118467786
N-benzyl-9-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-2-amine (PubChem CID 118467786) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is N-benzyl-9-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-2-amine.
| Compound Name | N-benzyl-9-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-2-amine |
|---|---|
| PubChem CID | 118467786 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-benzyl-9-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[4,5-b]quinolin-2-amine |
| SMILES | COc1ccc(-c2c3c(nc4nc(NCc5ccccc5)sc24)CCCC3)cc1 |
| InChI | InChI=1S/C24H23N3OS/c1-28-18-13-11-17(12-14-18)21-19-9-5-6-10-20(19)26-23-22(21)29-24(27-23)25-15-16-7-3-2-4-8-16/h2-4,7-8,11-14H,5-6,9-10,15H2,1H3,(H,25,26,27) |
| InChIKey | POOBYBZCBRUWPE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |