About methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate
methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate (PubChem CID 118468109) has the molecular formula C20H22O3
and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate.
Molecular Properties
| Compound Name | methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate |
| PubChem CID | 118468109 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate |
| SMILES | C=Cc1c(C(=O)OC)cc(Cc2ccc(OC)cc2)c(C)c1C |
| InChI | InChI=1S/C20H22O3/c1-6-18-14(3)13(2)16(12-19(18)20(21)23-5)11-15-7-9-17(22-4)10-8-15/h6-10,12H,1,11H2,2-5H3 |
| InChIKey | BWEJCCQMCCPZNR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate?
The IUPAC name of methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate (CID 118468109) is methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate.
What is the SMILES notation for methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate?
The canonical SMILES for methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate is C=Cc1c(C(=O)OC)cc(Cc2ccc(OC)cc2)c(C)c1C.
What is the InChIKey of methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate?
The InChIKey is BWEJCCQMCCPZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O3/c1-6-18-14(3)13(2)16(12-19(18)20(21)23-5)11-15-7-9-17(22-4)10-8-15/h6-10,12H,1,11H2,2-5H3.
What are the key properties of methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate?
methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate has a molecular weight of 310.39 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethenyl-5-[(4-methoxyphenyl)methyl]-3,4-dimethylbenzoate is sourced from PubChem (CID 118468109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).