About 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one
5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one (PubChem CID 118468507) has the molecular formula C13H13ClN4O2
and a molecular weight of 292.73 g/mol. Its IUPAC name is 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one.
Molecular Properties
| Compound Name | 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one |
| PubChem CID | 118468507 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one |
| SMILES | O=C1CCC(COc2nc(Cl)cc3nccnc23)CN1 |
| InChI | InChI=1S/C13H13ClN4O2/c14-10-5-9-12(16-4-3-15-9)13(18-10)20-7-8-1-2-11(19)17-6-8/h3-5,8H,1-2,6-7H2,(H,17,19) |
| InChIKey | KXJLOFIUFIFRBB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one?
The IUPAC name of 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one (CID 118468507) is 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one.
What is the SMILES notation for 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one?
The canonical SMILES for 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one is O=C1CCC(COc2nc(Cl)cc3nccnc23)CN1.
What is the InChIKey of 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one?
The InChIKey is KXJLOFIUFIFRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN4O2/c14-10-5-9-12(16-4-3-15-9)13(18-10)20-7-8-1-2-11(19)17-6-8/h3-5,8H,1-2,6-7H2,(H,17,19).
What are the key properties of 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one?
5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one has a molecular weight of 292.73 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(7-chloropyrido[3,4-b]pyrazin-5-yl)oxymethyl]piperidin-2-one is sourced from PubChem (CID 118468507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).