C11H6F3N3O3S — CID 118468556
(2,2,2-trifluoroacetyl) 5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxylate (PubChem CID 118468556) has the molecular formula C11H6F3N3O3S and a molecular weight of 317.25 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 118468556 |
| Molecular Formula | C11H6F3N3O3S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxylate |
| SMILES | Cc1ncc(-c2cnc(C(=O)OC(=O)C(F)(F)F)s2)cn1 |
| InChI | InChI=1S/C11H6F3N3O3S/c1-5-15-2-6(3-16-5)7-4-17-8(21-7)9(18)20-10(19)11(12,13)14/h2-4H,1H3 |
| InChIKey | WRDVDMGPYTZOJR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|