C23H25ClN4O5 — CID 118468628
N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrimidin-5-ylfuran-2-carboxamide (PubChem CID 118468628) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrimidin-5-ylfuran-2-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrimidin-5-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 118468628 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrimidin-5-ylfuran-2-carboxamide |
| SMILES | O=C(N[C@H](C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1)c1ccc(-c2cncnc2)o1 |
| InChI | InChI=1S/C23H25ClN4O5/c24-15-10-28(20-16(29)11-32-21(15)20)23(31)19(13-4-2-1-3-5-13)27-22(30)18-7-6-17(33-18)14-8-25-12-26-9-14/h6-9,12-13,15,19-21H,1-5,10-11H2,(H,27,30)/t15-,19-,20+,21+/m0/s1 |
| InChIKey | BVKBZERLIAEOOG-JWOSDPRPSA-N |
| XLogP | 2.20 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|