C25H28ClN3O5S — CID 118468670
N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methoxy-4-pyridinyl)thiophene-2-carboxamide (PubChem CID 118468670) has the molecular formula C25H28ClN3O5S and a molecular weight of 518.04 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methoxy-4-pyridinyl)thiophene-2-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methoxy-4-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 118468670 |
| Molecular Formula | C25H28ClN3O5S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methoxy-4-pyridinyl)thiophene-2-carboxamide |
| SMILES | COc1cc(-c2ccc(C(=O)N[C@H](C(=O)N3C[C@H](Cl)[C@H]4OCC(=O)[C@H]43)C3CCCCC3)s2)ccn1 |
| InChI | InChI=1S/C25H28ClN3O5S/c1-33-20-11-15(9-10-27-20)18-7-8-19(35-18)24(31)28-21(14-5-3-2-4-6-14)25(32)29-12-16(26)23-22(29)17(30)13-34-23/h7-11,14,16,21-23H,2-6,12-13H2,1H3,(H,28,31)/t16-,21-,22+,23+/m0/s1 |
| InChIKey | FLDXVFAWFMLTGY-SVCSISOJSA-N |
| XLogP | 3.28 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|