C23H26ClN5O4S — CID 118468724
N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 118468724) has the molecular formula C23H26ClN5O4S and a molecular weight of 504.01 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118468724 |
| Molecular Formula | C23H26ClN5O4S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cnccn2)sc1C(=O)N[C@H](C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C23H26ClN5O4S/c1-12-20(34-22(27-12)15-9-25-7-8-26-15)21(31)28-17(13-5-3-2-4-6-13)23(32)29-10-14(24)19-18(29)16(30)11-33-19/h7-9,13-14,17-19H,2-6,10-11H2,1H3,(H,28,31)/t14-,17-,18+,19+/m0/s1 |
| InChIKey | GXJMTVXMVCKZOI-WQANXHIZSA-N |
| XLogP | 2.37 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|