C15H14ClFN4O2 — CID 118468807
(4S)-3'-chloro-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-6H-chromeno[2,3-c]pyridine]-7',7'-diamine (PubChem CID 118468807) has the molecular formula C15H14ClFN4O2 and a molecular weight of 336.75 g/mol. Its IUPAC name is (4S)-3'-chloro-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-6H-chromeno[2,3-c]pyridine]-7',7'-diamine.
| Compound Name | (4S)-3'-chloro-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-6H-chromeno[2,3-c]pyridine]-7',7'-diamine |
|---|---|
| PubChem CID | 118468807 |
| Molecular Formula | C15H14ClFN4O2 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (4S)-3'-chloro-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-6H-chromeno[2,3-c]pyridine]-7',7'-diamine |
| SMILES | NC1(N)C=CC2=C(C1)[C@@]1(CCOC=N1)c1cc(Cl)nc(F)c1O2 |
| InChI | InChI=1S/C15H14ClFN4O2/c16-11-5-8-12(13(17)21-11)23-10-1-2-14(18,19)6-9(10)15(8)3-4-22-7-20-15/h1-2,5,7H,3-4,6,18-19H2/t15-/m1/s1 |
| InChIKey | VAWDLSJKXPBTFB-OAHLLOKOSA-N |
| XLogP | 1.74 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|