C20H20F3N3O5S — CID 118469004
(2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-[3-(trifluoromethyl)-4-pyridinyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide (PubChem CID 118469004) has the molecular formula C20H20F3N3O5S and a molecular weight of 471.46 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-[3-(trifluoromethyl)-4-pyridinyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide.
| Compound Name | (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-[3-(trifluoromethyl)-4-pyridinyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide |
|---|---|
| PubChem CID | 118469004 |
| Molecular Formula | C20H20F3N3O5S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-[3-(trifluoromethyl)-4-pyridinyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanamide |
| SMILES | C[C@@](C[C@H]1CC(c2ccc(-c3ccncc3C(F)(F)F)cc2)=NO1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C20H20F3N3O5S/c1-19(18(27)25-28,32(2,29)30)10-14-9-17(26-31-14)13-5-3-12(4-6-13)15-7-8-24-11-16(15)20(21,22)23/h3-8,11,14,28H,9-10H2,1-2H3,(H,25,27)/t14-,19-/m1/s1 |
| InChIKey | ZWSCVYBWYSGBCF-AUUYWEPGSA-N |
| XLogP | 2.96 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|