C20H22FN3O6S — CID 118469199
(2R)-3-[(5R)-3-[3-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide (PubChem CID 118469199) has the molecular formula C20H22FN3O6S and a molecular weight of 451.48 g/mol. Its IUPAC name is (2R)-3-[(5R)-3-[3-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | (2R)-3-[(5R)-3-[3-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118469199 |
| Molecular Formula | C20H22FN3O6S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (2R)-3-[(5R)-3-[3-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
| SMILES | COc1ccc(-c2ccc(C3=NO[C@@H](C[C@](C)(C(=O)NO)S(C)(=O)=O)C3)cc2F)cn1 |
| InChI | InChI=1S/C20H22FN3O6S/c1-20(19(25)23-26,31(3,27)28)10-14-9-17(24-30-14)12-4-6-15(16(21)8-12)13-5-7-18(29-2)22-11-13/h4-8,11,14,26H,9-10H2,1-3H3,(H,23,25)/t14-,20-/m1/s1 |
| InChIKey | LJECCVPJIACEBH-JLTOFOAXSA-N |
| XLogP | 2.09 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|