About (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one
(2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one (PubChem CID 118469870) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one.
Molecular Properties
| Compound Name | (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| PubChem CID | 118469870 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| SMILES | C[C@H](N)C(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C9H11NO4/c1-4(10)9(14)8-6(12)2-5(11)3-7(8)13/h2-4,11-13H,10H2,1H3/t4-/m0/s1 |
| InChIKey | CDOZQPYKEOCBOM-BYPYZUCNSA-N |
| XLogP | 0.33 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one?
The IUPAC name of (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one (CID 118469870) is (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one.
What is the SMILES notation for (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one?
The canonical SMILES for (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one is C[C@H](N)C(=O)c1c(O)cc(O)cc1O.
What is the InChIKey of (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one?
The InChIKey is CDOZQPYKEOCBOM-BYPYZUCNSA-N. The full InChI is InChI=1S/C9H11NO4/c1-4(10)9(14)8-6(12)2-5(11)3-7(8)13/h2-4,11-13H,10H2,1H3/t4-/m0/s1.
What are the key properties of (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one?
(2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one has a molecular weight of 197.19 g/mol, XLogP of 0.33, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1-(2,4,6-trihydroxyphenyl)propan-1-one is sourced from PubChem (CID 118469870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).