C24H26ClN3O5 — CID 118470756
N-[1-[(2S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]cyclohexyl]-2-oxoethyl]-5-pyridin-3-ylfuran-2-carboxamide (PubChem CID 118470756) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is N-[1-[(2S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]cyclohexyl]-2-oxoethyl]-5-pyridin-3-ylfuran-2-carboxamide.
| Compound Name | N-[1-[(2S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]cyclohexyl]-2-oxoethyl]-5-pyridin-3-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 118470756 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[1-[(2S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]cyclohexyl]-2-oxoethyl]-5-pyridin-3-ylfuran-2-carboxamide |
| SMILES | O=CC(NC(=O)c1ccc(-c2cccnc2)o1)C1CCCC[C@@H]1N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C24H26ClN3O5/c25-16-11-28(22-19(30)13-32-23(16)22)18-6-2-1-5-15(18)17(12-29)27-24(31)21-8-7-20(33-21)14-4-3-9-26-10-14/h3-4,7-10,12,15-18,22-23H,1-2,5-6,11,13H2,(H,27,31)/t15?,16-,17?,18-,22+,23+/m0/s1 |
| InChIKey | SJJWVSRUMXMMPP-GKVTZSEKSA-N |
| XLogP | 2.46 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|