C23H44O5Si — CID 11847077
methyl 2-[(2S,3S,4S,6R)-6-[(E,2S)-2-hydroxypent-3-enyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate (PubChem CID 11847077) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4S,6R)-6-[(E,2S)-2-hydroxypent-3-enyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,4S,6R)-6-[(E,2S)-2-hydroxypent-3-enyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 11847077 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | methyl 2-[(2S,3S,4S,6R)-6-[(E,2S)-2-hydroxypent-3-enyl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
| SMILES | C/C=C/[C@@H](O)C[C@@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@H](CC(=O)OC)O1 |
| InChI | InChI=1S/C23H44O5Si/c1-10-11-19(24)12-20-13-22(18(8)21(27-20)14-23(25)26-9)28-29(15(2)3,16(4)5)17(6)7/h10-11,15-22,24H,12-14H2,1-9H3/b11-10+/t18-,19+,20+,21-,22-/m0/s1 |
| InChIKey | SBVCLPDVLXLIQZ-MFHURUIDSA-N |
| XLogP | 5.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|