About 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine
4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine (PubChem CID 118470777) has the molecular formula C19H14ClN3OS
and a molecular weight of 367.86 g/mol. Its IUPAC name is 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine |
| PubChem CID | 118470777 |
| Molecular Formula | C19H14ClN3OS |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine |
| SMILES | Cc1ncnc(C)c1-c1ccc(Oc2nccc3sccc23)cc1Cl |
| InChI | InChI=1S/C19H14ClN3OS/c1-11-18(12(2)23-10-22-11)14-4-3-13(9-16(14)20)24-19-15-6-8-25-17(15)5-7-21-19/h3-10H,1-2H3 |
| InChIKey | HFYFUWUUNSWGON-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine?
The IUPAC name of 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine (CID 118470777) is 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine.
What is the SMILES notation for 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine?
The canonical SMILES for 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine is Cc1ncnc(C)c1-c1ccc(Oc2nccc3sccc23)cc1Cl.
What is the InChIKey of 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine?
The InChIKey is HFYFUWUUNSWGON-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3OS/c1-11-18(12(2)23-10-22-11)14-4-3-13(9-16(14)20)24-19-15-6-8-25-17(15)5-7-21-19/h3-10H,1-2H3.
What are the key properties of 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine?
4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine has a molecular weight of 367.86 g/mol, XLogP of 5.82, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-chloro-4-(4,6-dimethylpyrimidin-5-yl)phenoxy]thieno[3,2-c]pyridine is sourced from PubChem (CID 118470777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).