C17H28ClF3N4O5 — CID 11847088
prop-2-enyl (2R)-2-[[(2R)-2-[[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate;hydrochloride (PubChem CID 11847088) has the molecular formula C17H28ClF3N4O5 and a molecular weight of 460.88 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-[[(2R)-2-[[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate;hydrochloride.
| Compound Name | prop-2-enyl (2R)-2-[[(2R)-2-[[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 11847088 |
| Molecular Formula | C17H28ClF3N4O5 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | prop-2-enyl (2R)-2-[[(2R)-2-[[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate;hydrochloride |
| SMILES | C=CCOC(=O)[C@@H](C)NC(=O)[C@@H](C)NC(=O)[C@@H](N)CCCCNC(=O)C(F)(F)F.Cl |
| InChI | InChI=1S/C17H27F3N4O5.ClH/c1-4-9-29-15(27)11(3)24-13(25)10(2)23-14(26)12(21)7-5-6-8-22-16(28)17(18,19)20;/h4,10-12H,1,5-9,21H2,2-3H3,(H,22,28)(H,23,26)(H,24,25);1H/t10-,11-,12+;/m1./s1 |
| InChIKey | SWNOLVYOWLMAQM-HSASPSRMSA-N |
| XLogP | 0.32 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|