C18H22N6O3S — CID 118470885
3-[5-amino-6-(4-methylimidazol-1-yl)pyrazin-2-yl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide (PubChem CID 118470885) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-[5-amino-6-(4-methylimidazol-1-yl)pyrazin-2-yl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide.
| Compound Name | 3-[5-amino-6-(4-methylimidazol-1-yl)pyrazin-2-yl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 118470885 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 3-[5-amino-6-(4-methylimidazol-1-yl)pyrazin-2-yl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cn(-c2nc(-c3cc(S(=O)(=O)NCCCO)ccc3C)cnc2N)cn1 |
| InChI | InChI=1S/C18H22N6O3S/c1-12-4-5-14(28(26,27)22-6-3-7-25)8-15(12)16-9-20-17(19)18(23-16)24-10-13(2)21-11-24/h4-5,8-11,22,25H,3,6-7H2,1-2H3,(H2,19,20) |
| InChIKey | XYGRJAXICMRYEO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|