C21H20F3N5O2 — CID 118470969
[3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)methanone (PubChem CID 118470969) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is [3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)methanone.
| Compound Name | [3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)methanone |
|---|---|
| PubChem CID | 118470969 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | [3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)methanone |
| SMILES | Cc1cc(C2CN(C(=O)C3CCc4cc(F)ccc4O3)CC(F)(F)C2)n2ncnc2n1 |
| InChI | InChI=1S/C21H20F3N5O2/c1-12-6-16(29-20(27-12)25-11-26-29)14-8-21(23,24)10-28(9-14)19(30)18-4-2-13-7-15(22)3-5-17(13)31-18/h3,5-7,11,14,18H,2,4,8-10H2,1H3 |
| InChIKey | ZMZZFEOLXFRVPS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |