About 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one
3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one (PubChem CID 118471134) has the molecular formula C18H13BrN2O
and a molecular weight of 353.22 g/mol. Its IUPAC name is 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one.
Molecular Properties
| Compound Name | 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one |
| PubChem CID | 118471134 |
| Molecular Formula | C18H13BrN2O |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one |
| SMILES | O=c1[nH]c(Cc2ccccc2)cc2[nH]c3cc(Br)ccc3c12 |
| InChI | InChI=1S/C18H13BrN2O/c19-12-6-7-14-15(9-12)21-16-10-13(20-18(22)17(14)16)8-11-4-2-1-3-5-11/h1-7,9-10,21H,8H2,(H,20,22) |
| InChIKey | VHIAOHQNDMTBKW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one?
The IUPAC name of 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one (CID 118471134) is 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one.
What is the SMILES notation for 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one?
The canonical SMILES for 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one is O=c1[nH]c(Cc2ccccc2)cc2[nH]c3cc(Br)ccc3c12.
What is the InChIKey of 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one?
The InChIKey is VHIAOHQNDMTBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrN2O/c19-12-6-7-14-15(9-12)21-16-10-13(20-18(22)17(14)16)8-11-4-2-1-3-5-11/h1-7,9-10,21H,8H2,(H,20,22).
What are the key properties of 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one?
3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one has a molecular weight of 353.22 g/mol, XLogP of 4.36, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7-bromo-2,5-dihydropyrido[4,3-b]indol-1-one is sourced from PubChem (CID 118471134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).