About N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine
N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine (PubChem CID 11847122) has the molecular formula C20H24ClN3O
and a molecular weight of 357.88 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine |
| PubChem CID | 11847122 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CCCNc1ccnc2cc(Cl)ccc12)Cc1ccco1 |
| InChI | InChI=1S/C20H24ClN3O/c1-2-11-24(15-17-5-3-13-25-17)12-4-9-22-19-8-10-23-20-14-16(21)6-7-18(19)20/h3,5-8,10,13-14H,2,4,9,11-12,15H2,1H3,(H,22,23) |
| InChIKey | YSEDZWQJWIOUEU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine?
The IUPAC name of N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine (CID 11847122) is N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine.
What is the SMILES notation for N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine?
The canonical SMILES for N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine is CCCN(CCCNc1ccnc2cc(Cl)ccc12)Cc1ccco1.
What is the InChIKey of N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine?
The InChIKey is YSEDZWQJWIOUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClN3O/c1-2-11-24(15-17-5-3-13-25-17)12-4-9-22-19-8-10-23-20-14-16(21)6-7-18(19)20/h3,5-8,10,13-14H,2,4,9,11-12,15H2,1H3,(H,22,23).
What are the key properties of N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine?
N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine has a molecular weight of 357.88 g/mol, XLogP of 5.20, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 11847122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).