C10H9N3O2 — CID 118471265
2-(pyridin-4-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 118471265) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(pyridin-4-ylmethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 118471265 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-(pyridin-4-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(Cc2ccncc2)n1 |
| InChI | InChI=1S/C10H9N3O2/c11-10(14)8-6-15-9(13-8)5-7-1-3-12-4-2-7/h1-4,6H,5H2,(H2,11,14) |
| InChIKey | XMEJDHRIKFLMPY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |