C16H17ClF3N7O — CID 118471269
N'-[5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide (PubChem CID 118471269) has the molecular formula C16H17ClF3N7O and a molecular weight of 415.81 g/mol. Its IUPAC name is N'-[5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 118471269 |
| Molecular Formula | C16H17ClF3N7O |
| Molecular Weight | 415.81 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N'-[5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1cc(C(F)(F)F)c(-c2nc(Cl)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C16H17ClF3N7O/c1-26(2)9-22-12-7-11(16(18,19)20)10(8-21-12)13-23-14(17)25-15(24-13)27-3-5-28-6-4-27/h7-9H,3-6H2,1-2H3/b22-9+ |
| InChIKey | FCXHZVVWLVFMEX-LSFURLLWSA-N |
| XLogP | 2.66 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|