C27H31FN6O4 — CID 118471530
methyl 11-[(3-fluorophenyl)methyl]-13-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118471530) has the molecular formula C27H31FN6O4 and a molecular weight of 522.58 g/mol. Its IUPAC name is methyl 11-[(3-fluorophenyl)methyl]-13-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 11-[(3-fluorophenyl)methyl]-13-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118471530 |
| Molecular Formula | C27H31FN6O4 |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | methyl 11-[(3-fluorophenyl)methyl]-13-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3cccc(F)c3)nc(NCCCN(C)C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C27H31FN6O4/c1-27(2,3)38-26(36)34(4)11-7-10-29-23-21-22-19(14-17(15-30-22)25(35)37-5)31-24(21)33-20(32-23)13-16-8-6-9-18(28)12-16/h6,8-9,12,14-15H,7,10-11,13H2,1-5H3,(H2,29,31,32,33) |
| InChIKey | ZKZGKYVXAMHPIX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|