About (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate
(8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate (PubChem CID 118471865) has the molecular formula C13H15BrN2O4
and a molecular weight of 343.18 g/mol. Its IUPAC name is (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate.
Molecular Properties
| Compound Name | (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate |
| PubChem CID | 118471865 |
| Molecular Formula | C13H15BrN2O4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate |
| SMILES | CC(C)C1Oc2c(Br)cc(COC(N)=O)cc2NC1=O |
| InChI | InChI=1S/C13H15BrN2O4/c1-6(2)10-12(17)16-9-4-7(5-19-13(15)18)3-8(14)11(9)20-10/h3-4,6,10H,5H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | RBPGVFURYGMOFL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate?
The IUPAC name of (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate (CID 118471865) is (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate.
What is the SMILES notation for (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate?
The canonical SMILES for (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate is CC(C)C1Oc2c(Br)cc(COC(N)=O)cc2NC1=O.
What is the InChIKey of (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate?
The InChIKey is RBPGVFURYGMOFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O4/c1-6(2)10-12(17)16-9-4-7(5-19-13(15)18)3-8(14)11(9)20-10/h3-4,6,10H,5H2,1-2H3,(H2,15,18)(H,16,17).
What are the key properties of (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate?
(8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate has a molecular weight of 343.18 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-bromo-3-oxo-2-propan-2-yl-4H-1,4-benzoxazin-6-yl)methyl carbamate is sourced from PubChem (CID 118471865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).