C21H21F2N5O2 — CID 118472438
[3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(3,4-dihydro-2H-chromen-2-yl)methanone (PubChem CID 118472438) has the molecular formula C21H21F2N5O2 and a molecular weight of 413.43 g/mol. Its IUPAC name is [3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(3,4-dihydro-2H-chromen-2-yl)methanone.
| Compound Name | [3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(3,4-dihydro-2H-chromen-2-yl)methanone |
|---|---|
| PubChem CID | 118472438 |
| Molecular Formula | C21H21F2N5O2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(3,4-dihydro-2H-chromen-2-yl)methanone |
| SMILES | Cc1cc(C2CN(C(=O)C3CCc4ccccc4O3)CC(F)(F)C2)n2ncnc2n1 |
| InChI | InChI=1S/C21H21F2N5O2/c1-13-8-16(28-20(26-13)24-12-25-28)15-9-21(22,23)11-27(10-15)19(29)18-7-6-14-4-2-3-5-17(14)30-18/h2-5,8,12,15,18H,6-7,9-11H2,1H3 |
| InChIKey | LWOOOEOCLOQCSS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |